Compound Q&A

What precautions should be taken when handling 2,4-Dichloro-7-(trifluoromethyl)quinazoline (CAS: 396-02-1)?

Answer

2,4-Dichloro-7-(trifluoromethyl)quinazoline
When handling 2,4-Dichloro-7-(trifluoromethyl)quinazoline (CAS: 396-02-1), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated fume hood or a well-ventilated area. Spills should be cleaned up using appropriate absorbent materials and proper disposal procedures. Always refer to the Safety Data Sheet (SDS) for specific handling instructions and emergency procedures.

About

CAS No 396-02-1
English Name 2,4-Dichloro-7-(trifluoromethyl)quinazoline
Molecular Formula C9H3Cl2F3N2
Molecular Weight 267.04 g/mol
SMILES FC(F)(F)c1ccc2c(Cl)nc(Cl)nc2c1
InChIKey PRJBXUBPUYNFQF-UHFFFAOYSA-N
Last Updated: 2025-12-28 19:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4-Dichloro-7-(trifluoromethyl)quinazoline (CAS: 396-02-1)?

2,4-Dichloro-7-(trifluoromethyl)quinazoline (CAS: 396-02-1) is a solid crystalline compound with a m...

Compound Q&A

How is 2,4-Dichloro-7-(trifluoromethyl)quinazoline (CAS: 396-02-1) typically synthesized?

2,4-Dichloro-7-(trifluoromethyl)quinazoline (CAS: 396-02-1) is typically synthesized through a multi...

Compound Q&A

What industries use 2,4-Dichloro-7-(trifluoromethyl)quinazoline (CAS: 396-02-1)?

2,4-Dichloro-7-(trifluoromethyl)quinazoline (CAS: 396-02-1) is primarily used in pharmaceuticals for...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...