Compound Q&A

What industries use 2,4-Dichloro-7-(trifluoromethyl)quinazoline (CAS: 396-02-1)?

Answer

2,4-Dichloro-7-(trifluoromethyl)quinazoline
2,4-Dichloro-7-(trifluoromethyl)quinazoline (CAS: 396-02-1) is primarily used in pharmaceuticals for the development of potential anticancer and antiviral drugs. It is also utilized in the synthesis of various organic compounds and materials, including polymers and functional molecules for sensors and semiconductors.

About

CAS No 396-02-1
English Name 2,4-Dichloro-7-(trifluoromethyl)quinazoline
Molecular Formula C9H3Cl2F3N2
Molecular Weight 267.04 g/mol
SMILES FC(F)(F)c1ccc2c(Cl)nc(Cl)nc2c1
InChIKey PRJBXUBPUYNFQF-UHFFFAOYSA-N
Last Updated: 2025-12-28 19:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4-Dichloro-7-(trifluoromethyl)quinazoline (CAS: 396-02-1)?

2,4-Dichloro-7-(trifluoromethyl)quinazoline (CAS: 396-02-1) is a solid crystalline compound with a m...

Compound Q&A

How is 2,4-Dichloro-7-(trifluoromethyl)quinazoline (CAS: 396-02-1) typically synthesized?

2,4-Dichloro-7-(trifluoromethyl)quinazoline (CAS: 396-02-1) is typically synthesized through a multi...

Compound Q&A

What precautions should be taken when handling 2,4-Dichloro-7-(trifluoromethyl)quinazoline (CAS: 396-02-1)?

When handling 2,4-Dichloro-7-(trifluoromethyl)quinazoline (CAS: 396-02-1), it is essential to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...