Compound Q&A

What are the physical and chemical properties of 2,4-Dichloro-7-(trifluoromethyl)quinazoline (CAS: 396-02-1)?

Answer

2,4-Dichloro-7-(trifluoromethyl)quinazoline
2,4-Dichloro-7-(trifluoromethyl)quinazoline (CAS: 396-02-1) is a solid crystalline compound with a molecular weight of approximately 355.02 g/mol. It has low water solubility and high solubility in organic solvents like dichloromethane and acetonitrile. This compound is chemically stable but can react with reducing agents. It is insoluble in water and soluble in common organic solvents.

About

CAS No 396-02-1
English Name 2,4-Dichloro-7-(trifluoromethyl)quinazoline
Molecular Formula C9H3Cl2F3N2
Molecular Weight 267.04 g/mol
SMILES FC(F)(F)c1ccc2c(Cl)nc(Cl)nc2c1
InChIKey PRJBXUBPUYNFQF-UHFFFAOYSA-N
Last Updated: 2025-12-28 19:55

Related Q&A

Compound Q&A

How is 2,4-Dichloro-7-(trifluoromethyl)quinazoline (CAS: 396-02-1) typically synthesized?

2,4-Dichloro-7-(trifluoromethyl)quinazoline (CAS: 396-02-1) is typically synthesized through a multi...

Compound Q&A

What industries use 2,4-Dichloro-7-(trifluoromethyl)quinazoline (CAS: 396-02-1)?

2,4-Dichloro-7-(trifluoromethyl)quinazoline (CAS: 396-02-1) is primarily used in pharmaceuticals for...

Compound Q&A

What precautions should be taken when handling 2,4-Dichloro-7-(trifluoromethyl)quinazoline (CAS: 396-02-1)?

When handling 2,4-Dichloro-7-(trifluoromethyl)quinazoline (CAS: 396-02-1), it is essential to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...