Compound Q&A

How is 5,10,15,20-Tetrakis(4-nitrophenyl)porphyrin (CAS: 22843-73-8) typically synthesized?

Answer

5,10,15,20-Tetrakis(4-nitrophenyl)porphyrin
5,10,15,20-Tetrakis(4-nitrophenyl)porphyrin is synthesized through the condensation of 4-nitrophenyl chloroperoxidase with meso-tetraphenylporphyrin. The reaction involves the substitution of each phenyl group of the porphyrin with 4-nitrophenyl groups. This process typically requires a molar excess of 4-nitrophenyl chloroperoxidase and is conducted in non-aqueous solvents to enhance the reaction selectivity and yield.

About

CAS No 22843-73-8
English Name 5,10,15,20-Tetrakis(4-nitrophenyl)porphyrin
Molecular Formula C44H26N8O8
Molecular Weight 794.7 g/mol
SMILES C1=CC(=CC=C1C2=C3C=CC(=C(C4=NC(=C(C5=CC=C(N5)C(=C6C=CC2=N6)C7=CC=C(C=C7)[N+](=O)[O-])C8=CC=C(C=C8)[N+](=O)[O-])C=C4)C9=CC=C(C=C9)[N+](=O)[O-])N3)[N+](=O)[O-]
InChIKey FVHZCBQLLFLQAG-UHFFFAOYSA-N
Last Updated: 2025-12-28 14:56

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5,10,15,20-Tetrakis(4-nitrophenyl)porphyrin (CAS: 22843-73-8)?

5,10,15,20-Tetrakis(4-nitrophenyl)porphyrin (CAS: 22843-73-8) is a solid, crystalline compound with ...

Compound Q&A

What industries use 5,10,15,20-Tetrakis(4-nitrophenyl)porphyrin (CAS: 22843-73-8)?

5,10,15,20-Tetrakis(4-nitrophenyl)porphyrin (CAS: 22843-73-8) is used in various industries. It is p...

Compound Q&A

What precautions should be taken when handling 5,10,15,20-Tetrakis(4-nitrophenyl)porphyrin (CAS: 22843-73-8)?

When handling 5,10,15,20-Tetrakis(4-nitrophenyl)porphyrin (CAS: 22843-73-8), it is important to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...