Compound Q&A

What are the physical and chemical properties of 5,10,15,20-Tetrakis(4-nitrophenyl)porphyrin (CAS: 22843-73-8)?

Answer

5,10,15,20-Tetrakis(4-nitrophenyl)porphyrin
5,10,15,20-Tetrakis(4-nitrophenyl)porphyrin (CAS: 22843-73-8) is a solid, crystalline compound with a molecular weight of approximately 788.12 g/mol. It is poorly soluble in water but soluble in organic solvents such as chloroform. This compound has strong absorption in the visible region, making it useful for spectroscopic studies. It exhibits relatively high reactivity towards electron acceptors and can participate in various redox reactions.

About

CAS No 22843-73-8
English Name 5,10,15,20-Tetrakis(4-nitrophenyl)porphyrin
Molecular Formula C44H26N8O8
Molecular Weight 794.7 g/mol
SMILES C1=CC(=CC=C1C2=C3C=CC(=C(C4=NC(=C(C5=CC=C(N5)C(=C6C=CC2=N6)C7=CC=C(C=C7)[N+](=O)[O-])C8=CC=C(C=C8)[N+](=O)[O-])C=C4)C9=CC=C(C=C9)[N+](=O)[O-])N3)[N+](=O)[O-]
InChIKey FVHZCBQLLFLQAG-UHFFFAOYSA-N
Last Updated: 2025-12-28 14:56

Related Q&A

Compound Q&A

How is 5,10,15,20-Tetrakis(4-nitrophenyl)porphyrin (CAS: 22843-73-8) typically synthesized?

5,10,15,20-Tetrakis(4-nitrophenyl)porphyrin is synthesized through the condensation of 4-nitrophenyl...

Compound Q&A

What industries use 5,10,15,20-Tetrakis(4-nitrophenyl)porphyrin (CAS: 22843-73-8)?

5,10,15,20-Tetrakis(4-nitrophenyl)porphyrin (CAS: 22843-73-8) is used in various industries. It is p...

Compound Q&A

What precautions should be taken when handling 5,10,15,20-Tetrakis(4-nitrophenyl)porphyrin (CAS: 22843-73-8)?

When handling 5,10,15,20-Tetrakis(4-nitrophenyl)porphyrin (CAS: 22843-73-8), it is important to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...