Compound Q&A

What precautions should be taken when handling 2-(2-Thienyl)phenol (CAS: 106584-13-8)?

Answer

2-(2-Thienyl)phenol
When handling 2-(2-Thienyl)phenol (CAS: 106584-13-8), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be stored in a cool, dry place away from direct sunlight and heat sources. In case of a spill, use appropriate containment and clean up with care, as the compound can react with oxidizing agents. Always refer to the Safety Data Sheet (SDS) for detailed handling instructions.

About

English Name 2-(2-Thienyl)phenol
Molecular Formula C10H8OS
Molecular Weight 176.24 g/mol
SMILES C1=CC=C(C(=C1)C2=CC=CS2)O
InChIKey IGXFRPBULGVNKY-UHFFFAOYSA-N
Last Updated: 2025-12-28 14:56

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(2-Thienyl)phenol (CAS: 106584-13-8)?

2-(2-Thienyl)phenol (CAS: 106584-13-8) is a crystalline solid with a molecular weight of approximate...

Compound Q&A

How is 2-(2-Thienyl)phenol (CAS: 106584-13-8) typically synthesized?

2-(2-Thienyl)phenol is typically synthesized via the phenol-thiophene coupling reaction. A common me...

Compound Q&A

What industries use 2-(2-Thienyl)phenol (CAS: 106584-13-8)?

2-(2-Thienyl)phenol (CAS: 106584-13-8) is primarily used in the pharmaceutical and polymer industrie...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...