Compound Q&A

What are the physical and chemical properties of 2-(2-Thienyl)phenol (CAS: 106584-13-8)?

Answer

2-(2-Thienyl)phenol
2-(2-Thienyl)phenol (CAS: 106584-13-8) is a crystalline solid with a molecular weight of approximately 182.18 g/mol. It has a low melting point of about 73-74°C. The compound is slightly soluble in water but soluble in common organic solvents such as ethanol and acetone. It is chemically stable but can react with strong oxidizing agents and light exposure. This compound is often used in organic synthesis due to its reactivity.

About

English Name 2-(2-Thienyl)phenol
Molecular Formula C10H8OS
Molecular Weight 176.24 g/mol
SMILES C1=CC=C(C(=C1)C2=CC=CS2)O
InChIKey IGXFRPBULGVNKY-UHFFFAOYSA-N
Last Updated: 2025-12-28 14:56

Related Q&A

Compound Q&A

How is 2-(2-Thienyl)phenol (CAS: 106584-13-8) typically synthesized?

2-(2-Thienyl)phenol is typically synthesized via the phenol-thiophene coupling reaction. A common me...

Compound Q&A

What industries use 2-(2-Thienyl)phenol (CAS: 106584-13-8)?

2-(2-Thienyl)phenol (CAS: 106584-13-8) is primarily used in the pharmaceutical and polymer industrie...

Compound Q&A

What precautions should be taken when handling 2-(2-Thienyl)phenol (CAS: 106584-13-8)?

When handling 2-(2-Thienyl)phenol (CAS: 106584-13-8), it is essential to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...