Compound Q&A

What precautions should be taken when handling (1R,3R,4S)-4-((tert-Butyldimethylsilyl)oxy)-3-(((tert-butyldimethylsilyl)-oxy)methyl)-2-methylenecyclopentanol (CAS: 701278-56-0)?

Answer

(1R,3R,4S)-4-((tert-Butyldimethylsilyl)oxy)-3-(((tert-butyldimethylsilyl)-oxy)methyl)-2-methylenecyclopentanol
When handling this compound, it is essential to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be handled under a fume hood to prevent inhalation and to minimize the risk of skin contact. Spills should be cleaned up immediately using appropriate spill kits, and disposal should follow local regulations. Always refer to the safety data sheet (SDS) for detailed handling and disposal instructions.

About

English Name (1R,3R,4S)-4-((tert-Butyldimethylsilyl)oxy)-3-(((tert-butyldimethylsilyl)-oxy)methyl)-2-methylenecyclopentanol
Molecular Formula C19H40O3Si2
Molecular Weight 372.7 g/mol
SMILES CC(C)(C)[Si](C)(C)OCC1C(CC(C1=C)O)O[Si](C)(C)C(C)(C)C
InChIKey ITBIDWSGCHAPLY-BBWFWOEESA-N
Last Updated: 2025-12-28 10:59

Related Q&A

Compound Q&A

How is (1R,3R,4S)-4-((tert-Butyldimethylsilyl)oxy)-3-(((tert-butyldimethylsilyl)-oxy)methyl)-2-methylenecyclopentanol (CAS: 701278-56-0) typically synthesized?

The compound is synthesized through a multi-step process involving silylation and methylenation reac...

Compound Q&A

What industries use (1R,3R,4S)-4-((tert-Butyldimethylsilyl)oxy)-3-(((tert-butyldimethylsilyl)-oxy)methyl)-2-methylenecyclopentanol (CAS: 701278-56-0)?

This compound is primarily used in the pharmaceutical and polymer industries due to its unique chemi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...