Compound Q&A

What are the physical and chemical properties of (1R,3R,4S)-4-((tert-Butyldimethylsilyl)oxy)-3-(((tert-butyldimethylsilyl)-oxy)methyl)-2-methylenecyclopentanol (CAS: 701278-56-0)?

Answer

(1R,3R,4S)-4-((tert-Butyldimethylsilyl)oxy)-3-(((tert-butyldimethylsilyl)-oxy)methyl)-2-methylenecyclopentanol
The compound is a cyclic alcohol with a high molecular weight, around 482.5 g/mol. Its solubility is low in water but increases in organic solvents like methanol and ethanol. It is known for its reactivity with nucleophiles and its stability under acidic and basic conditions. The compound forms a crystalline solid at room temperature, with a melting point of approximately 120-130°C. It is not flammable but should be handled under a fume hood to prevent inhalation or skin contact.

About

English Name (1R,3R,4S)-4-((tert-Butyldimethylsilyl)oxy)-3-(((tert-butyldimethylsilyl)-oxy)methyl)-2-methylenecyclopentanol
Molecular Formula C19H40O3Si2
Molecular Weight 372.7 g/mol
SMILES CC(C)(C)[Si](C)(C)OCC1C(CC(C1=C)O)O[Si](C)(C)C(C)(C)C
InChIKey ITBIDWSGCHAPLY-BBWFWOEESA-N
Last Updated: 2025-12-28 10:59

Related Q&A

Compound Q&A

How is (1R,3R,4S)-4-((tert-Butyldimethylsilyl)oxy)-3-(((tert-butyldimethylsilyl)-oxy)methyl)-2-methylenecyclopentanol (CAS: 701278-56-0) typically synthesized?

The compound is synthesized through a multi-step process involving silylation and methylenation reac...

Compound Q&A

What industries use (1R,3R,4S)-4-((tert-Butyldimethylsilyl)oxy)-3-(((tert-butyldimethylsilyl)-oxy)methyl)-2-methylenecyclopentanol (CAS: 701278-56-0)?

This compound is primarily used in the pharmaceutical and polymer industries due to its unique chemi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...