Compound Q&A

What industries use (1R,3R,4S)-4-((tert-Butyldimethylsilyl)oxy)-3-(((tert-butyldimethylsilyl)-oxy)methyl)-2-methylenecyclopentanol (CAS: 701278-56-0)?

Answer

(1R,3R,4S)-4-((tert-Butyldimethylsilyl)oxy)-3-(((tert-butyldimethylsilyl)-oxy)methyl)-2-methylenecyclopentanol
This compound is primarily used in the pharmaceutical and polymer industries due to its unique chemical structure. It serves as a valuable intermediate in the synthesis of complex organic molecules and polymers with specific functionalities. Additionally, it can be utilized in the development of sensors and semiconductors for its reactivity and stability.

About

English Name (1R,3R,4S)-4-((tert-Butyldimethylsilyl)oxy)-3-(((tert-butyldimethylsilyl)-oxy)methyl)-2-methylenecyclopentanol
Molecular Formula C19H40O3Si2
Molecular Weight 372.7 g/mol
SMILES CC(C)(C)[Si](C)(C)OCC1C(CC(C1=C)O)O[Si](C)(C)C(C)(C)C
InChIKey ITBIDWSGCHAPLY-BBWFWOEESA-N
Last Updated: 2025-12-28 10:59

Related Q&A

Compound Q&A

How is (1R,3R,4S)-4-((tert-Butyldimethylsilyl)oxy)-3-(((tert-butyldimethylsilyl)-oxy)methyl)-2-methylenecyclopentanol (CAS: 701278-56-0) typically synthesized?

The compound is synthesized through a multi-step process involving silylation and methylenation reac...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...