Compound Q&A

What industries use 1-(2-Methyl-2-propanyl)-1,3-dihydro-2H-pyrrolo[2,3-b]pyridin-2-one (CAS: 1455358-06-1)?

Answer

1-(2-Methyl-2-propanyl)-1,3-dihydro-2H-pyrrolo[2,3-b]pyridin-2-one
1-(2-Methyl-2-propanyl)-1,3-dihydro-2H-pyrrolo[2,3-b]pyridin-2-one is used in the pharmaceutical industry as an intermediate in the synthesis of various drugs. It is also applicable in the polymer industry, where it can act as a stabilizer or additive, and in the sensor technology sector for its potential in developing highly sensitive detection systems.

About

English Name 1-(2-Methyl-2-propanyl)-1,3-dihydro-2H-pyrrolo[2,3-b]pyridin-2-one
Molecular Formula C11H14N2O
Molecular Weight 190.25 g/mol
SMILES O=C1Cc2c(N1C(C)(C)C)nccc2
InChIKey YCMRNCFOTBJUGG-UHFFFAOYSA-N
Last Updated: 2025-12-28 10:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(2-Methyl-2-propanyl)-1,3-dihydro-2H-pyrrolo[2,3-b]pyridin-2-one (CAS: 1455358-06-1)?

1-(2-Methyl-2-propanyl)-1,3-dihydro-2H-pyrrolo[2,3-b]pyridin-2-one is a crystalline solid with a mol...

Compound Q&A

How is 1-(2-Methyl-2-propanyl)-1,3-dihydro-2H-pyrrolo[2,3-b]pyridin-2-one (CAS: 1455358-06-1) typically synthesized?

1-(2-Methyl-2-propanyl)-1,3-dihydro-2H-pyrrolo[2,3-b]pyridin-2-one is typically synthesized through ...

Compound Q&A

What precautions should be taken when handling 1-(2-Methyl-2-propanyl)-1,3-dihydro-2H-pyrrolo[2,3-b]pyridin-2-one (CAS: 1455358-06-1)?

Proper handling of 1-(2-Methyl-2-propanyl)-1,3-dihydro-2H-pyrrolo[2,3-b]pyridin-2-one requires the u...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...