Compound Q&A

What are the physical and chemical properties of 1-(2-Methyl-2-propanyl)-1,3-dihydro-2H-pyrrolo[2,3-b]pyridin-2-one (CAS: 1455358-06-1)?

Answer

1-(2-Methyl-2-propanyl)-1,3-dihydro-2H-pyrrolo[2,3-b]pyridin-2-one
1-(2-Methyl-2-propanyl)-1,3-dihydro-2H-pyrrolo[2,3-b]pyridin-2-one is a crystalline solid with a molecular weight of approximately 237.3 g/mol. It is slightly soluble in water and has a high solubility in organic solvents like methanol and acetone. Reactivity is moderate, showing some basic character and moderate nucleophilicity. It is stable under normal conditions but should be stored away from strong acids and bases.

About

English Name 1-(2-Methyl-2-propanyl)-1,3-dihydro-2H-pyrrolo[2,3-b]pyridin-2-one
Molecular Formula C11H14N2O
Molecular Weight 190.25 g/mol
SMILES O=C1Cc2c(N1C(C)(C)C)nccc2
InChIKey YCMRNCFOTBJUGG-UHFFFAOYSA-N
Last Updated: 2025-12-28 10:59

Related Q&A

Compound Q&A

How is 1-(2-Methyl-2-propanyl)-1,3-dihydro-2H-pyrrolo[2,3-b]pyridin-2-one (CAS: 1455358-06-1) typically synthesized?

1-(2-Methyl-2-propanyl)-1,3-dihydro-2H-pyrrolo[2,3-b]pyridin-2-one is typically synthesized through ...

Compound Q&A

What industries use 1-(2-Methyl-2-propanyl)-1,3-dihydro-2H-pyrrolo[2,3-b]pyridin-2-one (CAS: 1455358-06-1)?

1-(2-Methyl-2-propanyl)-1,3-dihydro-2H-pyrrolo[2,3-b]pyridin-2-one is used in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling 1-(2-Methyl-2-propanyl)-1,3-dihydro-2H-pyrrolo[2,3-b]pyridin-2-one (CAS: 1455358-06-1)?

Proper handling of 1-(2-Methyl-2-propanyl)-1,3-dihydro-2H-pyrrolo[2,3-b]pyridin-2-one requires the u...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...