Compound Q&A

What precautions should be taken when handling 2,2',4-Trichlorobiphenyl (CAS: 37680-66-3)?

Answer

2,2',4-Trichlorobiphenyl
When handling 2,2',4-Trichlorobiphenyl (CAS: 37680-66-3), it is crucial to wear appropriate personal protective equipment (PPE), including gloves, safety goggles, and a lab coat. Work within a well-ventilated area or fume hood, as it is toxic and can cause skin irritation and respiratory issues. In case of a spill, immediately evacuate the area and contact the chemical safety officer. Always consult the Safety Data Sheet (SDS) for detailed safety instructions and emergency procedures.

About

CAS No 37680-66-3
English Name 2,2',4-Trichlorobiphenyl
Molecular Formula C12H7Cl3
Molecular Weight 257.55 g/mol
SMILES C1=CC=C(C(=C1)C2=C(C=C(C=C2)Cl)Cl)Cl
InChIKey YKKYCYQDUUXNLN-UHFFFAOYSA-N
Last Updated: 2025-12-28 06:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2',4-Trichlorobiphenyl (CAS: 37680-66-3)?

2,2',4-Trichlorobiphenyl (CAS: 37680-66-3) is a crystalline solid at room temperature with a high me...

Compound Q&A

How is 2,2',4-Trichlorobiphenyl (CAS: 37680-66-3) typically synthesized?

2,2',4-Trichlorobiphenyl is typically synthesized through a Friedel-Crafts alkylation reaction of bi...

Compound Q&A

What industries use 2,2',4-Trichlorobiphenyl (CAS: 37680-66-3)?

2,2',4-Trichlorobiphenyl (CAS: 37680-66-3) is used in various industries, particularly in the produc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...