Compound Q&A

What industries use 2,2',4-Trichlorobiphenyl (CAS: 37680-66-3)?

Answer

2,2',4-Trichlorobiphenyl
2,2',4-Trichlorobiphenyl (CAS: 37680-66-3) is used in various industries, particularly in the production of pesticides, plasticizers, and flame retardants. It has also been utilized in the synthesis of other chlorinated compounds for industrial applications. Due to environmental concerns, its use is limited in modern industrial practices, but it still finds occasional use in specialized applications where its properties are advantageous.

About

CAS No 37680-66-3
English Name 2,2',4-Trichlorobiphenyl
Molecular Formula C12H7Cl3
Molecular Weight 257.55 g/mol
SMILES C1=CC=C(C(=C1)C2=C(C=C(C=C2)Cl)Cl)Cl
InChIKey YKKYCYQDUUXNLN-UHFFFAOYSA-N
Last Updated: 2025-12-28 06:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2',4-Trichlorobiphenyl (CAS: 37680-66-3)?

2,2',4-Trichlorobiphenyl (CAS: 37680-66-3) is a crystalline solid at room temperature with a high me...

Compound Q&A

How is 2,2',4-Trichlorobiphenyl (CAS: 37680-66-3) typically synthesized?

2,2',4-Trichlorobiphenyl is typically synthesized through a Friedel-Crafts alkylation reaction of bi...

Compound Q&A

What precautions should be taken when handling 2,2',4-Trichlorobiphenyl (CAS: 37680-66-3)?

When handling 2,2',4-Trichlorobiphenyl (CAS: 37680-66-3), it is crucial to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...