Compound Q&A

What are the physical and chemical properties of 2,2',4-Trichlorobiphenyl (CAS: 37680-66-3)?

Answer

2,2',4-Trichlorobiphenyl
2,2',4-Trichlorobiphenyl (CAS: 37680-66-3) is a crystalline solid at room temperature with a high melting point. Its molecular weight is approximately 329.04 g/mol. This compound has low water solubility and moderate solubility in organic solvents like chloroform and acetone. It is relatively unreactive under normal conditions but can undergo substitution reactions under certain conditions. Due to its toxicity, it is important to handle with care and follow appropriate safety guidelines.

About

CAS No 37680-66-3
English Name 2,2',4-Trichlorobiphenyl
Molecular Formula C12H7Cl3
Molecular Weight 257.55 g/mol
SMILES C1=CC=C(C(=C1)C2=C(C=C(C=C2)Cl)Cl)Cl
InChIKey YKKYCYQDUUXNLN-UHFFFAOYSA-N
Last Updated: 2025-12-28 06:21

Related Q&A

Compound Q&A

How is 2,2',4-Trichlorobiphenyl (CAS: 37680-66-3) typically synthesized?

2,2',4-Trichlorobiphenyl is typically synthesized through a Friedel-Crafts alkylation reaction of bi...

Compound Q&A

What industries use 2,2',4-Trichlorobiphenyl (CAS: 37680-66-3)?

2,2',4-Trichlorobiphenyl (CAS: 37680-66-3) is used in various industries, particularly in the produc...

Compound Q&A

What precautions should be taken when handling 2,2',4-Trichlorobiphenyl (CAS: 37680-66-3)?

When handling 2,2',4-Trichlorobiphenyl (CAS: 37680-66-3), it is crucial to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...