Compound Q&A

How is 2,2',4-Trichlorobiphenyl (CAS: 37680-66-3) typically synthesized?

Answer

2,2',4-Trichlorobiphenyl
2,2',4-Trichlorobiphenyl is typically synthesized through a Friedel-Crafts alkylation reaction of biphenyl with chlorine gas in the presence of a Lewis acid catalyst like aluminum chloride. The reaction requires strict control of temperature and pressure to achieve high selectivity and yield. This method ensures that the chlorine atoms are added preferentially to the 2,2', and 4-positions of the biphenyl, leading to a high purity product.

About

CAS No 37680-66-3
English Name 2,2',4-Trichlorobiphenyl
Molecular Formula C12H7Cl3
Molecular Weight 257.55 g/mol
SMILES C1=CC=C(C(=C1)C2=C(C=C(C=C2)Cl)Cl)Cl
InChIKey YKKYCYQDUUXNLN-UHFFFAOYSA-N
Last Updated: 2025-12-28 06:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2',4-Trichlorobiphenyl (CAS: 37680-66-3)?

2,2',4-Trichlorobiphenyl (CAS: 37680-66-3) is a crystalline solid at room temperature with a high me...

Compound Q&A

What industries use 2,2',4-Trichlorobiphenyl (CAS: 37680-66-3)?

2,2',4-Trichlorobiphenyl (CAS: 37680-66-3) is used in various industries, particularly in the produc...

Compound Q&A

What precautions should be taken when handling 2,2',4-Trichlorobiphenyl (CAS: 37680-66-3)?

When handling 2,2',4-Trichlorobiphenyl (CAS: 37680-66-3), it is crucial to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...