Compound Q&A

What industries use 1-(2-Pyridinyl)-3-piperidinecarboxylic acid (CAS: 876718-04-6)?

Answer

1-(2-Pyridinyl)-3-piperidinecarboxylic acid
1-(2-Pyridinyl)-3-piperidinecarboxylic acid is used in the pharmaceutical industry as a precursor for drug synthesis, particularly in the development of anti-inflammatory and antiviral drugs. It is also utilized in polymer science for the modification of polymers and in the production of sensors and semiconductors.

About

English Name 1-(2-Pyridinyl)-3-piperidinecarboxylic acid
Molecular Formula C11H14N2O2
Molecular Weight 206.24 g/mol
SMILES O=C(C1CN(C2=NC=CC=C2)CCC1)O
InChIKey QZQCXIGVFAOJNE-UHFFFAOYSA-N
Last Updated: 2025-12-28 06:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(2-Pyridinyl)-3-piperidinecarboxylic acid (CAS: 876718-04-6)?

1-(2-Pyridinyl)-3-piperidinecarboxylic acid is a solid crystalline compound with a molecular weight ...

Compound Q&A

How is 1-(2-Pyridinyl)-3-piperidinecarboxylic acid (CAS: 876718-04-6) typically synthesized?

1-(2-Pyridinyl)-3-piperidinecarboxylic acid is synthesized by the condensation of 2-pyridinecarboxal...

Compound Q&A

What precautions should be taken when handling 1-(2-Pyridinyl)-3-piperidinecarboxylic acid (CAS: 876718-04-6)?

When handling 1-(2-Pyridinyl)-3-piperidinecarboxylic acid, it is crucial to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...