Compound Q&A

What are the physical and chemical properties of 1-(2-Pyridinyl)-3-piperidinecarboxylic acid (CAS: 876718-04-6)?

Answer

1-(2-Pyridinyl)-3-piperidinecarboxylic acid
1-(2-Pyridinyl)-3-piperidinecarboxylic acid is a solid crystalline compound with a molecular weight of approximately 220.22 g/mol. It has low solubility in water but is more soluble in organic solvents like methanol and ethanol. The compound is moderately reactive towards bases and can form salts. It decomposes above 300°C.

About

English Name 1-(2-Pyridinyl)-3-piperidinecarboxylic acid
Molecular Formula C11H14N2O2
Molecular Weight 206.24 g/mol
SMILES O=C(C1CN(C2=NC=CC=C2)CCC1)O
InChIKey QZQCXIGVFAOJNE-UHFFFAOYSA-N
Last Updated: 2025-12-28 06:21

Related Q&A

Compound Q&A

How is 1-(2-Pyridinyl)-3-piperidinecarboxylic acid (CAS: 876718-04-6) typically synthesized?

1-(2-Pyridinyl)-3-piperidinecarboxylic acid is synthesized by the condensation of 2-pyridinecarboxal...

Compound Q&A

What industries use 1-(2-Pyridinyl)-3-piperidinecarboxylic acid (CAS: 876718-04-6)?

1-(2-Pyridinyl)-3-piperidinecarboxylic acid is used in the pharmaceutical industry as a precursor fo...

Compound Q&A

What precautions should be taken when handling 1-(2-Pyridinyl)-3-piperidinecarboxylic acid (CAS: 876718-04-6)?

When handling 1-(2-Pyridinyl)-3-piperidinecarboxylic acid, it is crucial to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...