Compound Q&A

How should waste containing 1-Bromo-2-methyl-4,5-dinitrobenzene (CAS: 857001-14-0) be handled?

Answer

1-Bromo-2-methyl-4,5-dinitrobenzene
Waste containing 1-Bromo-2-methyl-4,5-dinitrobenzene (CAS: 857001-14-0) should be collected in appropriate containers and stored separately to prevent environmental contamination. Proper incineration or professional waste disposal methods should be used. It is crucial to follow local and international regulations for hazardous waste disposal. Environmental protection measures include ensuring that the waste is neutralized, if necessary, and that all safety precautions are taken to prevent accidental release during handling and disposal.

About

English Name 1-Bromo-2-methyl-4,5-dinitrobenzene
Molecular Formula C7H5BrN2O4
Molecular Weight 261.0296 g/mol
SMILES CC1=CC(=C(C=C1Br)[N+](=O)[O-])[N+](=O)[O-]
InChIKey DSQHAQRGHKMWNC-UHFFFAOYSA-N
Last Updated: 2025-12-26 07:10

Related Q&A

Compound Q&A

What regulatory guidelines apply to 1-Bromo-2-methyl-4,5-dinitrobenzene (CAS: 857001-14-0)?

1-Bromo-2-methyl-4,5-dinitrobenzene (CAS: 857001-14-0) falls under the scope of the Globally Harmoni...

Compound Q&A

Are there alternatives to 1-Bromo-2-methyl-4,5-dinitrobenzene (CAS: 857001-14-0) in synthesis?

For the synthesis of specific compounds, there are alternative reagents and methodologies that can b...

Compound Q&A

What is the market or research trend for 1-Bromo-2-methyl-4,5-dinitrobenzene (CAS: 857001-14-0)?

The market for 1-Bromo-2-methyl-4,5-dinitrobenzene (CAS: 857001-14-0) is primarily driven by its use...

Compound Q&A

How is 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3) typically synthesized?

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is typically s...

1187830-80-33-(2-Bromoimidazo[2,...
Compound Q&A

How is 2-Isopropyl-1,3-dioxane-5-carboxylic acid (CAS: 116193-72-7) typically synthesized?

2-Isopropyl-1,3-dioxane-5-carboxylic acid is typically synthesized by the carbox...

116193-72-72-Isopropyl-1,3-diox...
Compound Q&A

What is Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is an antiviral medication used in the treatment ...

254435-95-5Alisporivir
Compound Q&A

What are the physical and chemical properties of [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is a crystalline compound with...

234-80-0[1,2,4]triazolo[3,4-...