Compound Q&A

Are there alternatives to 1-Bromo-2-methyl-4,5-dinitrobenzene (CAS: 857001-14-0) in synthesis?

Answer

1-Bromo-2-methyl-4,5-dinitrobenzene
For the synthesis of specific compounds, there are alternative reagents and methodologies that can be used as substitutes for 1-Bromo-2-methyl-4,5-dinitrobenzene (CAS: 857001-14-0). For instance, other brominated and nitro-substituted benzenes can be employed. The choice of alternative depends on the desired product and the specific reaction conditions. Common alternatives include bromobenzene, nitrobenzene, and other aromatic compounds with similar functional groups.

About

English Name 1-Bromo-2-methyl-4,5-dinitrobenzene
Molecular Formula C7H5BrN2O4
Molecular Weight 261.0296 g/mol
SMILES CC1=CC(=C(C=C1Br)[N+](=O)[O-])[N+](=O)[O-]
InChIKey DSQHAQRGHKMWNC-UHFFFAOYSA-N
Last Updated: 2025-12-26 07:10

Related Q&A

Compound Q&A

What regulatory guidelines apply to 1-Bromo-2-methyl-4,5-dinitrobenzene (CAS: 857001-14-0)?

1-Bromo-2-methyl-4,5-dinitrobenzene (CAS: 857001-14-0) falls under the scope of the Globally Harmoni...

Compound Q&A

What is the market or research trend for 1-Bromo-2-methyl-4,5-dinitrobenzene (CAS: 857001-14-0)?

The market for 1-Bromo-2-methyl-4,5-dinitrobenzene (CAS: 857001-14-0) is primarily driven by its use...

Compound Q&A

How should waste containing 1-Bromo-2-methyl-4,5-dinitrobenzene (CAS: 857001-14-0) be handled?

Waste containing 1-Bromo-2-methyl-4,5-dinitrobenzene (CAS: 857001-14-0) should be collected in appro...

Compound Q&A

How is 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3) typically synthesized?

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is typically s...

1187830-80-33-(2-Bromoimidazo[2,...
Compound Q&A

How is 2-Isopropyl-1,3-dioxane-5-carboxylic acid (CAS: 116193-72-7) typically synthesized?

2-Isopropyl-1,3-dioxane-5-carboxylic acid is typically synthesized by the carbox...

116193-72-72-Isopropyl-1,3-diox...
Compound Q&A

What is Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is an antiviral medication used in the treatment ...

254435-95-5Alisporivir
Compound Q&A

What are the physical and chemical properties of [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is a crystalline compound with...

234-80-0[1,2,4]triazolo[3,4-...