Compound Q&A

What is the market or research trend for 1-Bromo-2-methyl-4,5-dinitrobenzene (CAS: 857001-14-0)?

Answer

1-Bromo-2-methyl-4,5-dinitrobenzene
The market for 1-Bromo-2-methyl-4,5-dinitrobenzene (CAS: 857001-14-0) is primarily driven by its use as an intermediate in the synthesis of various organic compounds, particularly in the pharmaceutical and research industries. Recent research trends indicate an increased focus on developing safer and more efficient synthetic routes. Additionally, there is growing interest in exploring the use of this compound in the preparation of new materials and in the field of explosives research.

About

English Name 1-Bromo-2-methyl-4,5-dinitrobenzene
Molecular Formula C7H5BrN2O4
Molecular Weight 261.0296 g/mol
SMILES CC1=CC(=C(C=C1Br)[N+](=O)[O-])[N+](=O)[O-]
InChIKey DSQHAQRGHKMWNC-UHFFFAOYSA-N
Last Updated: 2025-12-26 07:10

Related Q&A

Compound Q&A

What regulatory guidelines apply to 1-Bromo-2-methyl-4,5-dinitrobenzene (CAS: 857001-14-0)?

1-Bromo-2-methyl-4,5-dinitrobenzene (CAS: 857001-14-0) falls under the scope of the Globally Harmoni...

Compound Q&A

Are there alternatives to 1-Bromo-2-methyl-4,5-dinitrobenzene (CAS: 857001-14-0) in synthesis?

For the synthesis of specific compounds, there are alternative reagents and methodologies that can b...

Compound Q&A

How should waste containing 1-Bromo-2-methyl-4,5-dinitrobenzene (CAS: 857001-14-0) be handled?

Waste containing 1-Bromo-2-methyl-4,5-dinitrobenzene (CAS: 857001-14-0) should be collected in appro...

Compound Q&A

How is 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3) typically synthesized?

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is typically s...

1187830-80-33-(2-Bromoimidazo[2,...
Compound Q&A

How is 2-Isopropyl-1,3-dioxane-5-carboxylic acid (CAS: 116193-72-7) typically synthesized?

2-Isopropyl-1,3-dioxane-5-carboxylic acid is typically synthesized by the carbox...

116193-72-72-Isopropyl-1,3-diox...
Compound Q&A

What is Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is an antiviral medication used in the treatment ...

254435-95-5Alisporivir
Compound Q&A

What are the physical and chemical properties of [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is a crystalline compound with...

234-80-0[1,2,4]triazolo[3,4-...