Compound Q&A

What precautions should be taken when handling 1-Benzyl 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate (CAS: 3304-59-4)?

Answer

1-Benzyl 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate
When handling 1-Benzyl 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate (CAS: 3304-59-4), it is essential to wear appropriate personal protective equipment (PPE) including gloves, goggles, and a laboratory coat. This compound should be handled in a well-ventilated area or fume hood. Spills should be cleaned up immediately using appropriate absorbents. Always refer to the Safety Data Sheet (SDS) for detailed safety information and emergency procedures.

About

CAS No 3304-59-4
English Name 1-Benzyl 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate
Molecular Formula C19H18N2O6
Molecular Weight 370.4 g/mol
SMILES C1CC(N(C1)C(=O)OCC2=CC=CC=C2)C(=O)OC3=CC=C(C=C3)[N+](=O)[O-]
InChIKey GXUFIJVKXYWCAO-KRWDZBQOSA-N
Last Updated: 2025-12-26 02:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Benzyl 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate (CAS: 3304-59-4)?

1-Benzyl 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate (CAS: 3304-59-4) is a crystalline solid...

Compound Q&A

How is 1-Benzyl 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate (CAS: 3304-59-4) typically synthesized?

1-Benzyl 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate (CAS: 3304-59-4) is typically synthesiz...

Compound Q&A

What industries use 1-Benzyl 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate (CAS: 3304-59-4)?

1-Benzyl 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate (CAS: 3304-59-4) is primarily used in t...

Compound Q&A

How should waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane be handled?

Waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane (...

100751-65-3[(6-Bromo-2-naphthyl...
Compound Q&A

How is 7-Fluoro-4-isoquinolinecarboxylic acid (CAS: 1841081-40-0) typically synthesized?

7-Fluoro-4-isoquinolinecarboxylic acid can be synthesized via a multi-step proce...

1841081-40-07-Fluoro-4-isoquinol...
Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

2,3,5,6-Tetrabromothieno[3,2-b]thiophene is a crystalline compound with a high m...

124638-53-52,3,5,6-Tetrabromoth...
Compound Q&A

Is 1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide (CAS: 1542705-92-9) safe?

1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indol...

1542705-92-91-[4-(Benzylamino)-7...