Compound Q&A

How is 1-Benzyl 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate (CAS: 3304-59-4) typically synthesized?

Answer

1-Benzyl 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate
1-Benzyl 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate (CAS: 3304-59-4) is typically synthesized via a multistep process involving the condensation of 1-benzylpyrrolidine-2,3-dicarboxylic acid with 4-nitrophenyl boronic acid under palladium catalysis. Commonly used catalysts include Pd(PPh3)4 and B2pin2. The reaction yields the desired compound with good selectivity and is performed under mild conditions to avoid side reactions.

About

CAS No 3304-59-4
English Name 1-Benzyl 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate
Molecular Formula C19H18N2O6
Molecular Weight 370.4 g/mol
SMILES C1CC(N(C1)C(=O)OCC2=CC=CC=C2)C(=O)OC3=CC=C(C=C3)[N+](=O)[O-]
InChIKey GXUFIJVKXYWCAO-KRWDZBQOSA-N
Last Updated: 2025-12-26 02:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Benzyl 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate (CAS: 3304-59-4)?

1-Benzyl 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate (CAS: 3304-59-4) is a crystalline solid...

Compound Q&A

What industries use 1-Benzyl 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate (CAS: 3304-59-4)?

1-Benzyl 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate (CAS: 3304-59-4) is primarily used in t...

Compound Q&A

What precautions should be taken when handling 1-Benzyl 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate (CAS: 3304-59-4)?

When handling 1-Benzyl 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate (CAS: 3304-59-4), it is e...

Compound Q&A

How should waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane be handled?

Waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane (...

100751-65-3[(6-Bromo-2-naphthyl...
Compound Q&A

How is 7-Fluoro-4-isoquinolinecarboxylic acid (CAS: 1841081-40-0) typically synthesized?

7-Fluoro-4-isoquinolinecarboxylic acid can be synthesized via a multi-step proce...

1841081-40-07-Fluoro-4-isoquinol...
Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

2,3,5,6-Tetrabromothieno[3,2-b]thiophene is a crystalline compound with a high m...

124638-53-52,3,5,6-Tetrabromoth...
Compound Q&A

Is 1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide (CAS: 1542705-92-9) safe?

1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indol...

1542705-92-91-[4-(Benzylamino)-7...