Compound Q&A

What are the physical and chemical properties of 1-Benzyl 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate (CAS: 3304-59-4)?

Answer

1-Benzyl 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate
1-Benzyl 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate (CAS: 3304-59-4) is a crystalline solid with a molecular weight of approximately 318.13 g/mol. It has a low solubility in water but is soluble in organic solvents such as ethanol and dichloromethane. The compound is known for its stability under normal conditions but can react with strong bases and acids. It is used in the synthesis of various pharmaceuticals and materials due to its functional groups.

About

CAS No 3304-59-4
English Name 1-Benzyl 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate
Molecular Formula C19H18N2O6
Molecular Weight 370.4 g/mol
SMILES C1CC(N(C1)C(=O)OCC2=CC=CC=C2)C(=O)OC3=CC=C(C=C3)[N+](=O)[O-]
InChIKey GXUFIJVKXYWCAO-KRWDZBQOSA-N
Last Updated: 2025-12-26 02:37

Related Q&A

Compound Q&A

How is 1-Benzyl 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate (CAS: 3304-59-4) typically synthesized?

1-Benzyl 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate (CAS: 3304-59-4) is typically synthesiz...

Compound Q&A

What industries use 1-Benzyl 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate (CAS: 3304-59-4)?

1-Benzyl 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate (CAS: 3304-59-4) is primarily used in t...

Compound Q&A

What precautions should be taken when handling 1-Benzyl 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate (CAS: 3304-59-4)?

When handling 1-Benzyl 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate (CAS: 3304-59-4), it is e...

Compound Q&A

How should waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane be handled?

Waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane (...

100751-65-3[(6-Bromo-2-naphthyl...
Compound Q&A

How is 7-Fluoro-4-isoquinolinecarboxylic acid (CAS: 1841081-40-0) typically synthesized?

7-Fluoro-4-isoquinolinecarboxylic acid can be synthesized via a multi-step proce...

1841081-40-07-Fluoro-4-isoquinol...
Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

2,3,5,6-Tetrabromothieno[3,2-b]thiophene is a crystalline compound with a high m...

124638-53-52,3,5,6-Tetrabromoth...
Compound Q&A

Is 1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide (CAS: 1542705-92-9) safe?

1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indol...

1542705-92-91-[4-(Benzylamino)-7...