Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

Answer

2,3,5,6-Tetrabromothieno[3,2-b]thiophene
2,3,5,6-Tetrabromothieno[3,2-b]thiophene is a crystalline compound with a high melting point and low solubility in water. It has a molecular weight of approximately 317.9 g/mol. This compound is moderately reactive with strong bases and halogenating agents. It is used in organic synthesis and as a building block for functional materials.

About

English Name 2,3,5,6-Tetrabromothieno[3,2-b]thiophene
Molecular Formula C6Br4S2
Molecular Weight 455.81600000000003 g/mol
SMILES C12=C(C(=C(S1)Br)Br)SC(=C2Br)Br
InChIKey CWCKRNKYWPNOAZ-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

How is 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5) typically synthesized?

2,3,5,6-Tetrabromothieno[3,2-b]thiophene is synthesized via bromination of thieno[3,2-b]thiophene us...

Compound Q&A

What industries use 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

2,3,5,6-Tetrabromothieno[3,2-b]thiophene is used in the pharmaceutical industry for the synthesis of...

Compound Q&A

What precautions should be taken when handling 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

PPE such as gloves, goggles, and a lab coat should be worn when handling 2,3,5,6-Tetrabromothieno[3,...

Compound Q&A

How should waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane be handled?

Waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane (...

100751-65-3[(6-Bromo-2-naphthyl...
Compound Q&A

How is 7-Fluoro-4-isoquinolinecarboxylic acid (CAS: 1841081-40-0) typically synthesized?

7-Fluoro-4-isoquinolinecarboxylic acid can be synthesized via a multi-step proce...

1841081-40-07-Fluoro-4-isoquinol...
Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

2,3,5,6-Tetrabromothieno[3,2-b]thiophene is a crystalline compound with a high m...

124638-53-52,3,5,6-Tetrabromoth...
Compound Q&A

Is 1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide (CAS: 1542705-92-9) safe?

1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indol...

1542705-92-91-[4-(Benzylamino)-7...