Compound Q&A

What industries use 1-Benzyl 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate (CAS: 3304-59-4)?

Answer

1-Benzyl 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate
1-Benzyl 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate (CAS: 3304-59-4) is primarily used in the pharmaceutical and materials industries. It serves as a precursor for the synthesis of various drugs and polymers due to its reactive functional groups. Additionally, its use in sensing technology and semiconductor manufacturing is growing due to its unique structural properties.

About

CAS No 3304-59-4
English Name 1-Benzyl 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate
Molecular Formula C19H18N2O6
Molecular Weight 370.4 g/mol
SMILES C1CC(N(C1)C(=O)OCC2=CC=CC=C2)C(=O)OC3=CC=C(C=C3)[N+](=O)[O-]
InChIKey GXUFIJVKXYWCAO-KRWDZBQOSA-N
Last Updated: 2025-12-26 02:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Benzyl 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate (CAS: 3304-59-4)?

1-Benzyl 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate (CAS: 3304-59-4) is a crystalline solid...

Compound Q&A

How is 1-Benzyl 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate (CAS: 3304-59-4) typically synthesized?

1-Benzyl 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate (CAS: 3304-59-4) is typically synthesiz...

Compound Q&A

What precautions should be taken when handling 1-Benzyl 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate (CAS: 3304-59-4)?

When handling 1-Benzyl 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate (CAS: 3304-59-4), it is e...

Compound Q&A

How should waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane be handled?

Waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane (...

100751-65-3[(6-Bromo-2-naphthyl...
Compound Q&A

How is 7-Fluoro-4-isoquinolinecarboxylic acid (CAS: 1841081-40-0) typically synthesized?

7-Fluoro-4-isoquinolinecarboxylic acid can be synthesized via a multi-step proce...

1841081-40-07-Fluoro-4-isoquinol...
Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

2,3,5,6-Tetrabromothieno[3,2-b]thiophene is a crystalline compound with a high m...

124638-53-52,3,5,6-Tetrabromoth...
Compound Q&A

Is 1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide (CAS: 1542705-92-9) safe?

1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indol...

1542705-92-91-[4-(Benzylamino)-7...