Compound Q&A

What industries use Methyl 6-bromo-1-isopropyl-1H-indazole-4-carboxylate (CAS: 1346702-52-0)?

Answer

Methyl 6-bromo-1-isopropyl-1H-indazole-4-carboxylate
Methyl 6-bromo-1-isopropyl-1H-indazole-4-carboxylate is primarily used in the pharmaceutical industry for the synthesis of various indazole derivatives with potential medicinal applications. It is also explored in the chemical sensor industry for its reactivity and stability. Additionally, it may have applications in the development of organic semiconductors and as a precursor in polymer chemistry.

About

English Name Methyl 6-bromo-1-isopropyl-1H-indazole-4-carboxylate
Molecular Formula C12H13BrN2O2
Molecular Weight 297.15 g/mol
SMILES COC(=O)c1cc(Br)cc2c1cnn2C(C)C
InChIKey PNWPGLSNRZLQEG-UHFFFAOYSA-N
Last Updated: 2025-12-26 02:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 6-bromo-1-isopropyl-1H-indazole-4-carboxylate (CAS: 1346702-52-0)?

Methyl 6-bromo-1-isopropyl-1H-indazole-4-carboxylate is a solid with a crystalline form. Its molecul...

Compound Q&A

How is Methyl 6-bromo-1-isopropyl-1H-indazole-4-carboxylate (CAS: 1346702-52-0) typically synthesized?

Methyl 6-bromo-1-isopropyl-1H-indazole-4-carboxylate can be synthesized through the reaction of 1-is...

Compound Q&A

What precautions should be taken when handling Methyl 6-bromo-1-isopropyl-1H-indazole-4-carboxylate (CAS: 1346702-52-0)?

When handling Methyl 6-bromo-1-isopropyl-1H-indazole-4-carboxylate, it is essential to use appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...