Compound Q&A

How is Methyl 6-bromo-1-isopropyl-1H-indazole-4-carboxylate (CAS: 1346702-52-0) typically synthesized?

Answer

Methyl 6-bromo-1-isopropyl-1H-indazole-4-carboxylate
Methyl 6-bromo-1-isopropyl-1H-indazole-4-carboxylate can be synthesized through the reaction of 1-isopropyl-1H-indazole-4-carboxylic acid with bromine in the presence of a base such as sodium hydride. The key steps involve the bromination of the free carboxylic acid group to form the corresponding bromide, followed by its esterification with methyl alcohol. The reaction yields a high purity product with good selectivity and excellent yield.

About

English Name Methyl 6-bromo-1-isopropyl-1H-indazole-4-carboxylate
Molecular Formula C12H13BrN2O2
Molecular Weight 297.15 g/mol
SMILES COC(=O)c1cc(Br)cc2c1cnn2C(C)C
InChIKey PNWPGLSNRZLQEG-UHFFFAOYSA-N
Last Updated: 2025-12-26 02:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 6-bromo-1-isopropyl-1H-indazole-4-carboxylate (CAS: 1346702-52-0)?

Methyl 6-bromo-1-isopropyl-1H-indazole-4-carboxylate is a solid with a crystalline form. Its molecul...

Compound Q&A

What industries use Methyl 6-bromo-1-isopropyl-1H-indazole-4-carboxylate (CAS: 1346702-52-0)?

Methyl 6-bromo-1-isopropyl-1H-indazole-4-carboxylate is primarily used in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling Methyl 6-bromo-1-isopropyl-1H-indazole-4-carboxylate (CAS: 1346702-52-0)?

When handling Methyl 6-bromo-1-isopropyl-1H-indazole-4-carboxylate, it is essential to use appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...