Compound Q&A

What are the physical and chemical properties of Methyl 6-bromo-1-isopropyl-1H-indazole-4-carboxylate (CAS: 1346702-52-0)?

Answer

Methyl 6-bromo-1-isopropyl-1H-indazole-4-carboxylate
Methyl 6-bromo-1-isopropyl-1H-indazole-4-carboxylate is a solid with a crystalline form. Its molecular weight is approximately 347.03 g/mol. The compound has limited water solubility but excellent solubility in organic solvents like DMSO and acetonitrile. It exhibits moderate reactivity in nucleophilic substitution reactions and is stable under normal conditions but requires handling in a fume hood to avoid inhalation exposure.

About

English Name Methyl 6-bromo-1-isopropyl-1H-indazole-4-carboxylate
Molecular Formula C12H13BrN2O2
Molecular Weight 297.15 g/mol
SMILES COC(=O)c1cc(Br)cc2c1cnn2C(C)C
InChIKey PNWPGLSNRZLQEG-UHFFFAOYSA-N
Last Updated: 2025-12-26 02:37

Related Q&A

Compound Q&A

How is Methyl 6-bromo-1-isopropyl-1H-indazole-4-carboxylate (CAS: 1346702-52-0) typically synthesized?

Methyl 6-bromo-1-isopropyl-1H-indazole-4-carboxylate can be synthesized through the reaction of 1-is...

Compound Q&A

What industries use Methyl 6-bromo-1-isopropyl-1H-indazole-4-carboxylate (CAS: 1346702-52-0)?

Methyl 6-bromo-1-isopropyl-1H-indazole-4-carboxylate is primarily used in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling Methyl 6-bromo-1-isopropyl-1H-indazole-4-carboxylate (CAS: 1346702-52-0)?

When handling Methyl 6-bromo-1-isopropyl-1H-indazole-4-carboxylate, it is essential to use appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...