Compound Q&A

What precautions should be taken when handling 9-Ethylcarbazole-3-carboxaldehyde Diphenylhydrazone (CAS: 73276-70-7)?

Answer

9-Ethylcarbazole-3-carboxaldehyde Diphenylhydrazone
When handling 9-Ethylcarbazole-3-carboxaldehyde Diphenylhydrazone, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a laboratory coat. The compound should be stored in a cool, dry place away from direct sunlight and sources of heat. If a spill occurs, it should be cleaned up using appropriate spill kits. SDS (Safety Data Sheet) should be readily available, and fume hoods should be used during handling to minimize exposure to this compound. Handling should be performed with caution due to its potential reactivity under certain conditions.

About

CAS No 73276-70-7
English Name 9-Ethylcarbazole-3-carboxaldehyde Diphenylhydrazone
Molecular Formula C27H23N3
Molecular Weight 389.5 g/mol
SMILES CCN1C2=C(C=C(C=C2)C=NN(C3=CC=CC=C3)C4=CC=CC=C4)C5=CC=CC=C51
InChIKey CEAPHJPESODIQL-UHFFFAOYSA-N
Last Updated: 2025-12-26 02:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 9-Ethylcarbazole-3-carboxaldehyde Diphenylhydrazone (CAS: 73276-70-7)?

9-Ethylcarbazole-3-carboxaldehyde Diphenylhydrazone is a crystalline solid with a molecular weight o...

Compound Q&A

How is 9-Ethylcarbazole-3-carboxaldehyde Diphenylhydrazone (CAS: 73276-70-7) typically synthesized?

9-Ethylcarbazole-3-carboxaldehyde Diphenylhydrazone is synthesized through a multi-step process invo...

Compound Q&A

What industries use 9-Ethylcarbazole-3-carboxaldehyde Diphenylhydrazone (CAS: 73276-70-7)?

9-Ethylcarbazole-3-carboxaldehyde Diphenylhydrazone is predominantly used in the pharmaceutical indu...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...