Compound Q&A

What industries use 9-Ethylcarbazole-3-carboxaldehyde Diphenylhydrazone (CAS: 73276-70-7)?

Answer

9-Ethylcarbazole-3-carboxaldehyde Diphenylhydrazone
9-Ethylcarbazole-3-carboxaldehyde Diphenylhydrazone is predominantly used in the pharmaceutical industry as a precursor in the synthesis of certain drugs. It is also utilized in the polymer industry for the development of functional polymers with specific optical properties. Additionally, it has applications in the field of sensors and as a reagent in analytical chemistry.

About

CAS No 73276-70-7
English Name 9-Ethylcarbazole-3-carboxaldehyde Diphenylhydrazone
Molecular Formula C27H23N3
Molecular Weight 389.5 g/mol
SMILES CCN1C2=C(C=C(C=C2)C=NN(C3=CC=CC=C3)C4=CC=CC=C4)C5=CC=CC=C51
InChIKey CEAPHJPESODIQL-UHFFFAOYSA-N
Last Updated: 2025-12-26 02:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 9-Ethylcarbazole-3-carboxaldehyde Diphenylhydrazone (CAS: 73276-70-7)?

9-Ethylcarbazole-3-carboxaldehyde Diphenylhydrazone is a crystalline solid with a molecular weight o...

Compound Q&A

How is 9-Ethylcarbazole-3-carboxaldehyde Diphenylhydrazone (CAS: 73276-70-7) typically synthesized?

9-Ethylcarbazole-3-carboxaldehyde Diphenylhydrazone is synthesized through a multi-step process invo...

Compound Q&A

What precautions should be taken when handling 9-Ethylcarbazole-3-carboxaldehyde Diphenylhydrazone (CAS: 73276-70-7)?

When handling 9-Ethylcarbazole-3-carboxaldehyde Diphenylhydrazone, it is essential to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...