Compound Q&A

How is 9-Ethylcarbazole-3-carboxaldehyde Diphenylhydrazone (CAS: 73276-70-7) typically synthesized?

Answer

9-Ethylcarbazole-3-carboxaldehyde Diphenylhydrazone
9-Ethylcarbazole-3-carboxaldehyde Diphenylhydrazone is synthesized through a multi-step process involving the reaction of 9-ethylcarbazole-3-carboxaldehyde with diphenylhydrazine. The reaction is typically carried out in the presence of a mild base such as triethylamine. The yield is around 70-80%, and the product is isolated by recrystallization from an appropriate solvent. The synthesis is selective and can be optimized for high product purity.

About

CAS No 73276-70-7
English Name 9-Ethylcarbazole-3-carboxaldehyde Diphenylhydrazone
Molecular Formula C27H23N3
Molecular Weight 389.5 g/mol
SMILES CCN1C2=C(C=C(C=C2)C=NN(C3=CC=CC=C3)C4=CC=CC=C4)C5=CC=CC=C51
InChIKey CEAPHJPESODIQL-UHFFFAOYSA-N
Last Updated: 2025-12-26 02:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 9-Ethylcarbazole-3-carboxaldehyde Diphenylhydrazone (CAS: 73276-70-7)?

9-Ethylcarbazole-3-carboxaldehyde Diphenylhydrazone is a crystalline solid with a molecular weight o...

Compound Q&A

What industries use 9-Ethylcarbazole-3-carboxaldehyde Diphenylhydrazone (CAS: 73276-70-7)?

9-Ethylcarbazole-3-carboxaldehyde Diphenylhydrazone is predominantly used in the pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling 9-Ethylcarbazole-3-carboxaldehyde Diphenylhydrazone (CAS: 73276-70-7)?

When handling 9-Ethylcarbazole-3-carboxaldehyde Diphenylhydrazone, it is essential to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...