Compound Q&A

What are the physical and chemical properties of 9-Ethylcarbazole-3-carboxaldehyde Diphenylhydrazone (CAS: 73276-70-7)?

Answer

9-Ethylcarbazole-3-carboxaldehyde Diphenylhydrazone
9-Ethylcarbazole-3-carboxaldehyde Diphenylhydrazone is a crystalline solid with a molecular weight of approximately 344.33 g/mol. It has a low solubility in water but is highly soluble in organic solvents such as ethanol and acetone. Chemically, it is moderately reactive, showing good stability under normal conditions but may undergo hydrolysis in aqueous solutions. This compound is primarily used in analytical chemistry as a chromophore and in the synthesis of other organic compounds.

About

CAS No 73276-70-7
English Name 9-Ethylcarbazole-3-carboxaldehyde Diphenylhydrazone
Molecular Formula C27H23N3
Molecular Weight 389.5 g/mol
SMILES CCN1C2=C(C=C(C=C2)C=NN(C3=CC=CC=C3)C4=CC=CC=C4)C5=CC=CC=C51
InChIKey CEAPHJPESODIQL-UHFFFAOYSA-N
Last Updated: 2025-12-26 02:37

Related Q&A

Compound Q&A

How is 9-Ethylcarbazole-3-carboxaldehyde Diphenylhydrazone (CAS: 73276-70-7) typically synthesized?

9-Ethylcarbazole-3-carboxaldehyde Diphenylhydrazone is synthesized through a multi-step process invo...

Compound Q&A

What industries use 9-Ethylcarbazole-3-carboxaldehyde Diphenylhydrazone (CAS: 73276-70-7)?

9-Ethylcarbazole-3-carboxaldehyde Diphenylhydrazone is predominantly used in the pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling 9-Ethylcarbazole-3-carboxaldehyde Diphenylhydrazone (CAS: 73276-70-7)?

When handling 9-Ethylcarbazole-3-carboxaldehyde Diphenylhydrazone, it is essential to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...