Compound Q&A

What precautions should be taken when handling 2-Chloro-4-(2-naphthyl)-6-phenyl-1,3,5-triazine (CAS: 1342819-12-8)?

Answer

2-Chloro-4-(2-naphthyl)-6-phenyl-1,3,5-triazine
When handling 2-Chloro-4-(2-naphthyl)-6-phenyl-1,3,5-triazine (CAS: 1342819-12-8), safety precautions include wearing personal protective equipment such as gloves, goggles, and a lab coat. It should be stored in a cool, dry place away from direct sunlight and heat sources. Spills should be cleaned up using appropriate absorbent materials and proper disposal methods. Always refer to the safety data sheet (SDS) for detailed information and safety guidelines.

About

English Name 2-Chloro-4-(2-naphthyl)-6-phenyl-1,3,5-triazine
Molecular Formula C19H12ClN3
Molecular Weight 317.78 g/mol
SMILES c1ccc(cc1)c2nc(nc(n2)Cl)c3ccc4ccccc4c3
InChIKey KTTRHLOWOKRRKS-UHFFFAOYSA-N
Last Updated: 2025-12-25 22:28

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Chloro-4-(2-naphthyl)-6-phenyl-1,3,5-triazine (CAS: 1342819-12-8)?

2-Chloro-4-(2-naphthyl)-6-phenyl-1,3,5-triazine (CAS: 1342819-12-8) is a crystalline solid with a mo...

Compound Q&A

How is 2-Chloro-4-(2-naphthyl)-6-phenyl-1,3,5-triazine (CAS: 1342819-12-8) typically synthesized?

2-Chloro-4-(2-naphthyl)-6-phenyl-1,3,5-triazine (CAS: 1342819-12-8) is typically synthesized through...

Compound Q&A

What industries use 2-Chloro-4-(2-naphthyl)-6-phenyl-1,3,5-triazine (CAS: 1342819-12-8)?

2-Chloro-4-(2-naphthyl)-6-phenyl-1,3,5-triazine (CAS: 1342819-12-8) is used in various industries, p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...