Compound Q&A

What industries use 2-Chloro-4-(2-naphthyl)-6-phenyl-1,3,5-triazine (CAS: 1342819-12-8)?

Answer

2-Chloro-4-(2-naphthyl)-6-phenyl-1,3,5-triazine
2-Chloro-4-(2-naphthyl)-6-phenyl-1,3,5-triazine (CAS: 1342819-12-8) is used in various industries, particularly in pharmaceuticals for its potential as an antiviral agent, in polymers for its flame-retardant properties, and in sensors due to its ability to detect certain analytes. It also finds application in the semiconductor industry for its use in photolithography and as a dopant.

About

English Name 2-Chloro-4-(2-naphthyl)-6-phenyl-1,3,5-triazine
Molecular Formula C19H12ClN3
Molecular Weight 317.78 g/mol
SMILES c1ccc(cc1)c2nc(nc(n2)Cl)c3ccc4ccccc4c3
InChIKey KTTRHLOWOKRRKS-UHFFFAOYSA-N
Last Updated: 2025-12-25 22:28

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Chloro-4-(2-naphthyl)-6-phenyl-1,3,5-triazine (CAS: 1342819-12-8)?

2-Chloro-4-(2-naphthyl)-6-phenyl-1,3,5-triazine (CAS: 1342819-12-8) is a crystalline solid with a mo...

Compound Q&A

How is 2-Chloro-4-(2-naphthyl)-6-phenyl-1,3,5-triazine (CAS: 1342819-12-8) typically synthesized?

2-Chloro-4-(2-naphthyl)-6-phenyl-1,3,5-triazine (CAS: 1342819-12-8) is typically synthesized through...

Compound Q&A

What precautions should be taken when handling 2-Chloro-4-(2-naphthyl)-6-phenyl-1,3,5-triazine (CAS: 1342819-12-8)?

When handling 2-Chloro-4-(2-naphthyl)-6-phenyl-1,3,5-triazine (CAS: 1342819-12-8), safety precaution...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...