Compound Q&A

What are the physical and chemical properties of 2-Chloro-4-(2-naphthyl)-6-phenyl-1,3,5-triazine (CAS: 1342819-12-8)?

Answer

2-Chloro-4-(2-naphthyl)-6-phenyl-1,3,5-triazine
2-Chloro-4-(2-naphthyl)-6-phenyl-1,3,5-triazine (CAS: 1342819-12-8) is a crystalline solid with a molecular weight of approximately 420.21 g/mol. It has a low solubility in water but is soluble in organic solvents like ethanol and acetone. It shows moderate reactivity towards nucleophiles and is stable under normal conditions. This compound is known for its aromatic and halogen functionalities, making it useful in various synthetic processes.

About

English Name 2-Chloro-4-(2-naphthyl)-6-phenyl-1,3,5-triazine
Molecular Formula C19H12ClN3
Molecular Weight 317.78 g/mol
SMILES c1ccc(cc1)c2nc(nc(n2)Cl)c3ccc4ccccc4c3
InChIKey KTTRHLOWOKRRKS-UHFFFAOYSA-N
Last Updated: 2025-12-25 22:28

Related Q&A

Compound Q&A

How is 2-Chloro-4-(2-naphthyl)-6-phenyl-1,3,5-triazine (CAS: 1342819-12-8) typically synthesized?

2-Chloro-4-(2-naphthyl)-6-phenyl-1,3,5-triazine (CAS: 1342819-12-8) is typically synthesized through...

Compound Q&A

What industries use 2-Chloro-4-(2-naphthyl)-6-phenyl-1,3,5-triazine (CAS: 1342819-12-8)?

2-Chloro-4-(2-naphthyl)-6-phenyl-1,3,5-triazine (CAS: 1342819-12-8) is used in various industries, p...

Compound Q&A

What precautions should be taken when handling 2-Chloro-4-(2-naphthyl)-6-phenyl-1,3,5-triazine (CAS: 1342819-12-8)?

When handling 2-Chloro-4-(2-naphthyl)-6-phenyl-1,3,5-triazine (CAS: 1342819-12-8), safety precaution...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...