Compound Q&A

How is 2-Chloro-4-(2-naphthyl)-6-phenyl-1,3,5-triazine (CAS: 1342819-12-8) typically synthesized?

Answer

2-Chloro-4-(2-naphthyl)-6-phenyl-1,3,5-triazine
2-Chloro-4-(2-naphthyl)-6-phenyl-1,3,5-triazine (CAS: 1342819-12-8) is typically synthesized through a multi-step process involving the coupling of 2-naphthylamine, chlorophenyl isocyanate, and 1,3,5-triazine. The reaction is catalyzed by a suitable base such as potassium carbonate, and high yields are achieved under mild conditions. This synthesis involves careful control of temperature and reaction time to ensure product purity and yield.

About

English Name 2-Chloro-4-(2-naphthyl)-6-phenyl-1,3,5-triazine
Molecular Formula C19H12ClN3
Molecular Weight 317.78 g/mol
SMILES c1ccc(cc1)c2nc(nc(n2)Cl)c3ccc4ccccc4c3
InChIKey KTTRHLOWOKRRKS-UHFFFAOYSA-N
Last Updated: 2025-12-25 22:28

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Chloro-4-(2-naphthyl)-6-phenyl-1,3,5-triazine (CAS: 1342819-12-8)?

2-Chloro-4-(2-naphthyl)-6-phenyl-1,3,5-triazine (CAS: 1342819-12-8) is a crystalline solid with a mo...

Compound Q&A

What industries use 2-Chloro-4-(2-naphthyl)-6-phenyl-1,3,5-triazine (CAS: 1342819-12-8)?

2-Chloro-4-(2-naphthyl)-6-phenyl-1,3,5-triazine (CAS: 1342819-12-8) is used in various industries, p...

Compound Q&A

What precautions should be taken when handling 2-Chloro-4-(2-naphthyl)-6-phenyl-1,3,5-triazine (CAS: 1342819-12-8)?

When handling 2-Chloro-4-(2-naphthyl)-6-phenyl-1,3,5-triazine (CAS: 1342819-12-8), safety precaution...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...