Compound Q&A

What industries use 4-[(3-Chloro-2-fluorophenyl)amino]-7-methoxy-6-quinazolinyl acetate (CAS: 740081-22-5)?

Answer

4-[(3-Chloro-2-fluorophenyl)amino]-7-methoxy-6-quinazolinyl acetate
4-[(3-Chloro-2-fluorophenyl)amino]-7-methoxy-6-quinazolinyl acetate is primarily used in the pharmaceutical industry for the development of novel drugs. It also has potential applications in the polymer industry for the synthesis of advanced materials and in the semiconductor industry for the fabrication of electronic devices and sensors. Its specific functionalities make it a valuable compound in these fields.

About

English Name 4-[(3-Chloro-2-fluorophenyl)amino]-7-methoxy-6-quinazolinyl acetate
Molecular Formula C17H13ClFN3O3
Molecular Weight 361.76 g/mol
SMILES CC(OC1=CC2=C(NC3=CC=CC(Cl)=C3F)N=CN=C2C=C1OC)=O
InChIKey YJNQYSVKLRFVQN-UHFFFAOYSA-N
Last Updated: 2025-12-25 13:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-[(3-Chloro-2-fluorophenyl)amino]-7-methoxy-6-quinazolinyl acetate (CAS: 740081-22-5)?

4-[(3-Chloro-2-fluorophenyl)amino]-7-methoxy-6-quinazolinyl acetate is a white crystalline solid. It...

Compound Q&A

How is 4-[(3-Chloro-2-fluorophenyl)amino]-7-methoxy-6-quinazolinyl acetate (CAS: 740081-22-5) typically synthesized?

4-[(3-Chloro-2-fluorophenyl)amino]-7-methoxy-6-quinazolinyl acetate can be synthesized via a multi-s...

Compound Q&A

What precautions should be taken when handling 4-[(3-Chloro-2-fluorophenyl)amino]-7-methoxy-6-quinazolinyl acetate (CAS: 740081-22-5)?

When handling 4-[(3-Chloro-2-fluorophenyl)amino]-7-methoxy-6-quinazolinyl acetate, it is essential t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...