Compound Q&A

How is 4-[(3-Chloro-2-fluorophenyl)amino]-7-methoxy-6-quinazolinyl acetate (CAS: 740081-22-5) typically synthesized?

Answer

4-[(3-Chloro-2-fluorophenyl)amino]-7-methoxy-6-quinazolinyl acetate
4-[(3-Chloro-2-fluorophenyl)amino]-7-methoxy-6-quinazolinyl acetate can be synthesized via a multi-step process involving the condensation of 3-(chloro-2-fluorophenyl)hydrazine with 7-methoxy-6-quinazoline, followed by acetylation. Commonly used acids include acetic anhydride, and the reaction is typically carried out in the presence of a catalyst such as pyridine. The product exhibits high selectivity and yield under optimized conditions.

About

English Name 4-[(3-Chloro-2-fluorophenyl)amino]-7-methoxy-6-quinazolinyl acetate
Molecular Formula C17H13ClFN3O3
Molecular Weight 361.76 g/mol
SMILES CC(OC1=CC2=C(NC3=CC=CC(Cl)=C3F)N=CN=C2C=C1OC)=O
InChIKey YJNQYSVKLRFVQN-UHFFFAOYSA-N
Last Updated: 2025-12-25 13:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-[(3-Chloro-2-fluorophenyl)amino]-7-methoxy-6-quinazolinyl acetate (CAS: 740081-22-5)?

4-[(3-Chloro-2-fluorophenyl)amino]-7-methoxy-6-quinazolinyl acetate is a white crystalline solid. It...

Compound Q&A

What industries use 4-[(3-Chloro-2-fluorophenyl)amino]-7-methoxy-6-quinazolinyl acetate (CAS: 740081-22-5)?

4-[(3-Chloro-2-fluorophenyl)amino]-7-methoxy-6-quinazolinyl acetate is primarily used in the pharmac...

Compound Q&A

What precautions should be taken when handling 4-[(3-Chloro-2-fluorophenyl)amino]-7-methoxy-6-quinazolinyl acetate (CAS: 740081-22-5)?

When handling 4-[(3-Chloro-2-fluorophenyl)amino]-7-methoxy-6-quinazolinyl acetate, it is essential t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...