Compound Q&A

What are the physical and chemical properties of 4-[(3-Chloro-2-fluorophenyl)amino]-7-methoxy-6-quinazolinyl acetate (CAS: 740081-22-5)?

Answer

4-[(3-Chloro-2-fluorophenyl)amino]-7-methoxy-6-quinazolinyl acetate
4-[(3-Chloro-2-fluorophenyl)amino]-7-methoxy-6-quinazolinyl acetate is a white crystalline solid. Its molecular weight is approximately 453.18 g/mol. It has low solubility in water but good solubility in organic solvents such as methanol and acetonitrile. The compound exhibits moderate reactivity towards nucleophiles and is stable under normal storage conditions. It does not readily decompose under acidic or basic conditions.

About

English Name 4-[(3-Chloro-2-fluorophenyl)amino]-7-methoxy-6-quinazolinyl acetate
Molecular Formula C17H13ClFN3O3
Molecular Weight 361.76 g/mol
SMILES CC(OC1=CC2=C(NC3=CC=CC(Cl)=C3F)N=CN=C2C=C1OC)=O
InChIKey YJNQYSVKLRFVQN-UHFFFAOYSA-N
Last Updated: 2025-12-25 13:43

Related Q&A

Compound Q&A

How is 4-[(3-Chloro-2-fluorophenyl)amino]-7-methoxy-6-quinazolinyl acetate (CAS: 740081-22-5) typically synthesized?

4-[(3-Chloro-2-fluorophenyl)amino]-7-methoxy-6-quinazolinyl acetate can be synthesized via a multi-s...

Compound Q&A

What industries use 4-[(3-Chloro-2-fluorophenyl)amino]-7-methoxy-6-quinazolinyl acetate (CAS: 740081-22-5)?

4-[(3-Chloro-2-fluorophenyl)amino]-7-methoxy-6-quinazolinyl acetate is primarily used in the pharmac...

Compound Q&A

What precautions should be taken when handling 4-[(3-Chloro-2-fluorophenyl)amino]-7-methoxy-6-quinazolinyl acetate (CAS: 740081-22-5)?

When handling 4-[(3-Chloro-2-fluorophenyl)amino]-7-methoxy-6-quinazolinyl acetate, it is essential t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...