Compound Q&A

What precautions should be taken when handling Cytochalasin E (CAS: 36011-19-5)?

Answer

Cytochalasin E
When handling Cytochalasin E (CAS: 36011-19-5), it is essential to follow safety guidelines and use appropriate personal protective equipment (PPE) such as gloves and safety goggles. Work should be conducted in a fume hood to minimize inhalation risks. In case of a spill, use absorbent materials and clean up according to standard laboratory safety protocols. Always refer to the Material Safety Data Sheet (MSDS) for detailed safety information.

About

CAS No 36011-19-5
English Name Cytochalasin E
Molecular Formula C28H33NO7
Molecular Weight 495.57 g/mol
SMILES CC1CC=CC2C3C(O3)(C(C4C2(C(=O)NC4CC5=CC=CC=C5)OC(=O)OC=CC(C1=O)(C)O)C)C
InChIKey LAJXCUNOQSHRJO-ZYGJITOWSA-N
Last Updated: 2025-12-25 13:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of Cytochalasin E (CAS: 36011-19-5)?

Cytochalasin E (CAS: 36011-19-5) is a cyclic tetrapeptide with a molecular weight of approximately 6...

Compound Q&A

How is Cytochalasin E (CAS: 36011-19-5) typically synthesized?

Cytochalasin E (CAS: 36011-19-5) is typically synthesized through complex multi-step processes invol...

Compound Q&A

What industries use Cytochalasin E (CAS: 36011-19-5)?

Cytochalasin E (CAS: 36011-19-5) is primarily used in the pharmaceutical industry for its role in ce...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...