Compound Q&A

What industries use Cytochalasin E (CAS: 36011-19-5)?

Answer

Cytochalasin E
Cytochalasin E (CAS: 36011-19-5) is primarily used in the pharmaceutical industry for its role in cell biology research and as a tool for studying actin dynamics. It is also used in the polymer industry for its potential applications in material science and in the development of new polymers with specific properties.

About

CAS No 36011-19-5
English Name Cytochalasin E
Molecular Formula C28H33NO7
Molecular Weight 495.57 g/mol
SMILES CC1CC=CC2C3C(O3)(C(C4C2(C(=O)NC4CC5=CC=CC=C5)OC(=O)OC=CC(C1=O)(C)O)C)C
InChIKey LAJXCUNOQSHRJO-ZYGJITOWSA-N
Last Updated: 2025-12-25 13:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of Cytochalasin E (CAS: 36011-19-5)?

Cytochalasin E (CAS: 36011-19-5) is a cyclic tetrapeptide with a molecular weight of approximately 6...

Compound Q&A

How is Cytochalasin E (CAS: 36011-19-5) typically synthesized?

Cytochalasin E (CAS: 36011-19-5) is typically synthesized through complex multi-step processes invol...

Compound Q&A

What precautions should be taken when handling Cytochalasin E (CAS: 36011-19-5)?

When handling Cytochalasin E (CAS: 36011-19-5), it is essential to follow safety guidelines and use ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...