Compound Q&A

How is Cytochalasin E (CAS: 36011-19-5) typically synthesized?

Answer

Cytochalasin E
Cytochalasin E (CAS: 36011-19-5) is typically synthesized through complex multi-step processes involving peptide coupling reactions and chemical modifications. Commonly, these syntheses involve the use of protected amino acids, followed by deprotection and coupling to form the cyclic tetrapeptide structure. The yield and selectivity of these processes are critical for obtaining pure Cytochalasin E.

About

CAS No 36011-19-5
English Name Cytochalasin E
Molecular Formula C28H33NO7
Molecular Weight 495.57 g/mol
SMILES CC1CC=CC2C3C(O3)(C(C4C2(C(=O)NC4CC5=CC=CC=C5)OC(=O)OC=CC(C1=O)(C)O)C)C
InChIKey LAJXCUNOQSHRJO-ZYGJITOWSA-N
Last Updated: 2025-12-25 13:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of Cytochalasin E (CAS: 36011-19-5)?

Cytochalasin E (CAS: 36011-19-5) is a cyclic tetrapeptide with a molecular weight of approximately 6...

Compound Q&A

What industries use Cytochalasin E (CAS: 36011-19-5)?

Cytochalasin E (CAS: 36011-19-5) is primarily used in the pharmaceutical industry for its role in ce...

Compound Q&A

What precautions should be taken when handling Cytochalasin E (CAS: 36011-19-5)?

When handling Cytochalasin E (CAS: 36011-19-5), it is essential to follow safety guidelines and use ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...