Compound Q&A

What precautions should be taken when handling 3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid (CAS: 128426-86-8)?

Answer

3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid
When handling 3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid, it is crucial to wear appropriate personal protective equipment (PPE), including gloves and safety goggles. Store the compound in a fume hood to minimize exposure to air and handle it in a well-ventilated area. In case of spill, contain the spill using appropriate absorbents and dispose of it according to local regulations. Always refer to the Safety Data Sheet (SDS) for detailed handling and disposal information.

About

English Name 3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid
Molecular Formula C8H3F5O3
Molecular Weight 242.1 g/mol
SMILES C1=C(C(=C(C(=C1F)F)OC(F)F)F)C(=O)O
InChIKey XKNIFQLRUBLKKI-UHFFFAOYSA-N
Last Updated: 2025-12-25 13:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid (CAS: 128426-86-8)?

3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid is a crystalline solid with a molecular weight of ap...

Compound Q&A

How is 3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid (CAS: 128426-86-8) typically synthesized?

3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid is typically synthesized through a multi-step proces...

Compound Q&A

What industries use 3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid (CAS: 128426-86-8)?

3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid is used in the pharmaceutical industry for the synth...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...