Compound Q&A

What industries use 3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid (CAS: 128426-86-8)?

Answer

3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid
3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid is used in the pharmaceutical industry for the synthesis of various drug candidates due to its unique structural properties. It is also found in the polymer industry for the development of advanced materials, and in the sensor and semiconductor industries for its electronic properties.

About

English Name 3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid
Molecular Formula C8H3F5O3
Molecular Weight 242.1 g/mol
SMILES C1=C(C(=C(C(=C1F)F)OC(F)F)F)C(=O)O
InChIKey XKNIFQLRUBLKKI-UHFFFAOYSA-N
Last Updated: 2025-12-25 13:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid (CAS: 128426-86-8)?

3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid is a crystalline solid with a molecular weight of ap...

Compound Q&A

How is 3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid (CAS: 128426-86-8) typically synthesized?

3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid is typically synthesized through a multi-step proces...

Compound Q&A

What precautions should be taken when handling 3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid (CAS: 128426-86-8)?

When handling 3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid, it is crucial to wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...