Compound Q&A

How is 3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid (CAS: 128426-86-8) typically synthesized?

Answer

3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid
3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid is typically synthesized through a multi-step process involving bromination, substitution, and acylation. Commonly, the synthesis involves reacting 2,4,5-trifluorobenzoic acid with a difluoromethoxy electrophile in the presence of a base and a suitable catalyst to achieve high selectivity and yield.

About

English Name 3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid
Molecular Formula C8H3F5O3
Molecular Weight 242.1 g/mol
SMILES C1=C(C(=C(C(=C1F)F)OC(F)F)F)C(=O)O
InChIKey XKNIFQLRUBLKKI-UHFFFAOYSA-N
Last Updated: 2025-12-25 13:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid (CAS: 128426-86-8)?

3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid is a crystalline solid with a molecular weight of ap...

Compound Q&A

What industries use 3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid (CAS: 128426-86-8)?

3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid is used in the pharmaceutical industry for the synth...

Compound Q&A

What precautions should be taken when handling 3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid (CAS: 128426-86-8)?

When handling 3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid, it is crucial to wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...