Compound Q&A

What are the physical and chemical properties of 3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid (CAS: 128426-86-8)?

Answer

3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid
3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid is a crystalline solid with a molecular weight of approximately 285.03 g/mol. It has a low solubility in water but good solubility in organic solvents like DMSO and acetonitrile. Chemically, it is highly reactive due to the presence of multiple fluorine atoms, which enhance its acidity and make it susceptible to nucleophilic substitution reactions.

About

English Name 3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid
Molecular Formula C8H3F5O3
Molecular Weight 242.1 g/mol
SMILES C1=C(C(=C(C(=C1F)F)OC(F)F)F)C(=O)O
InChIKey XKNIFQLRUBLKKI-UHFFFAOYSA-N
Last Updated: 2025-12-25 13:43

Related Q&A

Compound Q&A

How is 3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid (CAS: 128426-86-8) typically synthesized?

3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid is typically synthesized through a multi-step proces...

Compound Q&A

What industries use 3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid (CAS: 128426-86-8)?

3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid is used in the pharmaceutical industry for the synth...

Compound Q&A

What precautions should be taken when handling 3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid (CAS: 128426-86-8)?

When handling 3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid, it is crucial to wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...