Compound Q&A

What industries use Methyl 6-bromoimidazo[1,2-a]pyridine-2-carboxylate (CAS: 354548-08-6)?

Answer

Methyl 6-bromoimidazo[1,2-a]pyridine-2-carboxylate
Methyl 6-bromoimidazo[1,2-a]pyridine-2-carboxylate (CAS: 354548-08-6) is used in the pharmaceutical industry for the development of potential drug candidates. It is also utilized in the sensor industry due to its reactivity and stability properties. Additionally, it may have applications in the synthesis of functional polymers and as a precursor in semiconductor manufacturing.

About

English Name Methyl 6-bromoimidazo[1,2-a]pyridine-2-carboxylate
Molecular Formula C9H7BrN2O2
Molecular Weight 255.07 g/mol
SMILES COC(=O)C1=CN2C=C(C=CC2=N1)Br
InChIKey DCQQILZPUHSRGM-UHFFFAOYSA-N
Last Updated: 2025-12-25 08:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 6-bromoimidazo[1,2-a]pyridine-2-carboxylate (CAS: 354548-08-6)?

Methyl 6-bromoimidazo[1,2-a]pyridine-2-carboxylate (CAS: 354548-08-6) is a crystalline solid with a ...

Compound Q&A

How is Methyl 6-bromoimidazo[1,2-a]pyridine-2-carboxylate (CAS: 354548-08-6) typically synthesized?

Methyl 6-bromoimidazo[1,2-a]pyridine-2-carboxylate is typically synthesized through an aromatic subs...

Compound Q&A

What precautions should be taken when handling Methyl 6-bromoimidazo[1,2-a]pyridine-2-carboxylate (CAS: 354548-08-6)?

When handling Methyl 6-bromoimidazo[1,2-a]pyridine-2-carboxylate (CAS: 354548-08-6), it is essential...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...