Compound Q&A

What are the physical and chemical properties of Methyl 6-bromoimidazo[1,2-a]pyridine-2-carboxylate (CAS: 354548-08-6)?

Answer

Methyl 6-bromoimidazo[1,2-a]pyridine-2-carboxylate
Methyl 6-bromoimidazo[1,2-a]pyridine-2-carboxylate (CAS: 354548-08-6) is a crystalline solid with a molecular weight of approximately 281.03 g/mol. It has a high solubility in polar organic solvents such as DMSO and moderate solubility in water. The compound is moderately reactive and can undergo substitution reactions. It is stable under normal laboratory conditions but should be stored away from strong bases and reducing agents.

About

English Name Methyl 6-bromoimidazo[1,2-a]pyridine-2-carboxylate
Molecular Formula C9H7BrN2O2
Molecular Weight 255.07 g/mol
SMILES COC(=O)C1=CN2C=C(C=CC2=N1)Br
InChIKey DCQQILZPUHSRGM-UHFFFAOYSA-N
Last Updated: 2025-12-25 08:48

Related Q&A

Compound Q&A

How is Methyl 6-bromoimidazo[1,2-a]pyridine-2-carboxylate (CAS: 354548-08-6) typically synthesized?

Methyl 6-bromoimidazo[1,2-a]pyridine-2-carboxylate is typically synthesized through an aromatic subs...

Compound Q&A

What industries use Methyl 6-bromoimidazo[1,2-a]pyridine-2-carboxylate (CAS: 354548-08-6)?

Methyl 6-bromoimidazo[1,2-a]pyridine-2-carboxylate (CAS: 354548-08-6) is used in the pharmaceutical ...

Compound Q&A

What precautions should be taken when handling Methyl 6-bromoimidazo[1,2-a]pyridine-2-carboxylate (CAS: 354548-08-6)?

When handling Methyl 6-bromoimidazo[1,2-a]pyridine-2-carboxylate (CAS: 354548-08-6), it is essential...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...