Compound Q&A

What precautions should be taken when handling 2,2'-Dibromo-4,4'-diiodobiphenyl (CAS: 852138-93-3)?

Answer

2,2'-Dibromo-4,4'-diiodobiphenyl
When handling 2,2'-Dibromo-4,4'-diiodobiphenyl (CAS: 852138-93-3), it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be cleaned up with caution, and the area should be thoroughly decontaminated. Always refer to the safety data sheet (SDS) for detailed handling and emergency procedures.

About

English Name 2,2'-Dibromo-4,4'-diiodobiphenyl
Molecular Formula C12H6Br2I2
Molecular Weight 563.8 g/mol
SMILES c1cc(c(cc1I)Br)c2ccc(cc2Br)I
InChIKey MJZNAWMPPSJRJX-UHFFFAOYSA-N
Last Updated: 2025-12-25 08:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2'-Dibromo-4,4'-diiodobiphenyl (CAS: 852138-93-3)?

2,2'-Dibromo-4,4'-diiodobiphenyl (CAS: 852138-93-3) is a crystalline solid with a molecular weight o...

Compound Q&A

How is 2,2'-Dibromo-4,4'-diiodobiphenyl (CAS: 852138-93-3) typically synthesized?

2,2'-Dibromo-4,4'-diiodobiphenyl is typically synthesized through the bromination and subsequent iod...

Compound Q&A

What industries use 2,2'-Dibromo-4,4'-diiodobiphenyl (CAS: 852138-93-3)?

2,2'-Dibromo-4,4'-diiodobiphenyl (CAS: 852138-93-3) is used in the pharmaceutical industry for the s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...